C21H23Cl2N3O2 — CID 89319669
5-amino-1-[(2,5-dichlorophenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide (PubChem CID 89319669) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 5-amino-1-[(2,5-dichlorophenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide.
| Compound Name | 5-amino-1-[(2,5-dichlorophenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 89319669 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 5-amino-1-[(2,5-dichlorophenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide |
| SMILES | CC(C)(CO)CNC(=O)c1cc2cc(N)ccc2n1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-21(2,12-27)11-25-20(28)19-9-13-8-16(24)4-6-18(13)26(19)10-14-7-15(22)3-5-17(14)23/h3-9,27H,10-12,24H2,1-2H3,(H,25,28) |
| InChIKey | FZDSXZMJKCLEMV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|