C22H34N5O3+ — CID 89320425
ethyl (2Z)-2-[[4-(diethylamino)-2-ethoxyphenyl]-methylhydrazinylidene]-2-(1,3-dimethylimidazol-1-ium-2-yl)acetate (PubChem CID 89320425) has the molecular formula C22H34N5O3+ and a molecular weight of 416.55 g/mol. Its IUPAC name is ethyl (2Z)-2-[[4-(diethylamino)-2-ethoxyphenyl]-methylhydrazinylidene]-2-(1,3-dimethylimidazol-1-ium-2-yl)acetate.
| Compound Name | ethyl (2Z)-2-[[4-(diethylamino)-2-ethoxyphenyl]-methylhydrazinylidene]-2-(1,3-dimethylimidazol-1-ium-2-yl)acetate |
|---|---|
| PubChem CID | 89320425 |
| Molecular Formula | C22H34N5O3+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | ethyl (2Z)-2-[[4-(diethylamino)-2-ethoxyphenyl]-methylhydrazinylidene]-2-(1,3-dimethylimidazol-1-ium-2-yl)acetate |
| SMILES | CCOC(=O)/C(=N\N(C)c1ccc(N(CC)CC)cc1OCC)c1n(C)cc[n+]1C |
| InChI | InChI=1S/C22H34N5O3/c1-8-27(9-2)17-12-13-18(19(16-17)29-10-3)26(7)23-20(22(28)30-11-4)21-24(5)14-15-25(21)6/h12-16H,8-11H2,1-7H3/q+1 |
| InChIKey | JYMXFQKYEQYRJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|