C11H26OSi — CID 89321938
3,5-dimethylhexan-3-yloxy(trimethyl)silane (PubChem CID 89321938) has the molecular formula C11H26OSi and a molecular weight of 202.41 g/mol. Its IUPAC name is 3,5-dimethylhexan-3-yloxy(trimethyl)silane.
| Compound Name | 3,5-dimethylhexan-3-yloxy(trimethyl)silane |
|---|---|
| PubChem CID | 89321938 |
| Molecular Formula | C11H26OSi |
| Molecular Weight | 202.41 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | 3,5-dimethylhexan-3-yloxy(trimethyl)silane |
| SMILES | CCC(C)(CC(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H26OSi/c1-8-11(4,9-10(2)3)12-13(5,6)7/h10H,8-9H2,1-7H3 |
| InChIKey | RDKXBTPYKKRGNR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|