C17H24N4O4 — CID 89322324
2,2,5,5-tetramethylhexan-3-yl 4-azido-3-nitrobenzoate (PubChem CID 89322324) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2,2,5,5-tetramethylhexan-3-yl 4-azido-3-nitrobenzoate.
| Compound Name | 2,2,5,5-tetramethylhexan-3-yl 4-azido-3-nitrobenzoate |
|---|---|
| PubChem CID | 89322324 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2,2,5,5-tetramethylhexan-3-yl 4-azido-3-nitrobenzoate |
| SMILES | CC(C)(C)CC(OC(=O)c1ccc(N=[N+]=[N-])c([N+](=O)[O-])c1)C(C)(C)C |
| InChI | InChI=1S/C17H24N4O4/c1-16(2,3)10-14(17(4,5)6)25-15(22)11-7-8-12(19-20-18)13(9-11)21(23)24/h7-9,14H,10H2,1-6H3 |
| InChIKey | LKENOXCLQMIKSM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 118.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|