C23H23FN2O5S — CID 89322922
3-[4-[2-amino-3-[1-(4-fluorophenyl)ethenyl]-6-oxo-1-pyridinyl]phenoxy]propyl methanesulfonate (PubChem CID 89322922) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[4-[2-amino-3-[1-(4-fluorophenyl)ethenyl]-6-oxo-1-pyridinyl]phenoxy]propyl methanesulfonate.
| Compound Name | 3-[4-[2-amino-3-[1-(4-fluorophenyl)ethenyl]-6-oxo-1-pyridinyl]phenoxy]propyl methanesulfonate |
|---|---|
| PubChem CID | 89322922 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 3-[4-[2-amino-3-[1-(4-fluorophenyl)ethenyl]-6-oxo-1-pyridinyl]phenoxy]propyl methanesulfonate |
| SMILES | C=C(c1ccc(F)cc1)c1ccc(=O)n(-c2ccc(OCCCOS(C)(=O)=O)cc2)c1N |
| InChI | InChI=1S/C23H23FN2O5S/c1-16(17-4-6-18(24)7-5-17)21-12-13-22(27)26(23(21)25)19-8-10-20(11-9-19)30-14-3-15-31-32(2,28)29/h4-13H,1,3,14-15,25H2,2H3 |
| InChIKey | SLPCNLSKLOVZKR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|