C22H21F6IO5S — CID 89323031
methyl 2-[3-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)phenyl]-4-methylpentanoate (PubChem CID 89323031) has the molecular formula C22H21F6IO5S and a molecular weight of 638.36 g/mol. Its IUPAC name is methyl 2-[3-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)phenyl]-4-methylpentanoate.
| Compound Name | methyl 2-[3-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)phenyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 89323031 |
| Molecular Formula | C22H21F6IO5S |
| Molecular Weight | 638.36 g/mol |
| Exact Mass | 638.01 |
| IUPAC Name | methyl 2-[3-[4-(iodomethyl)-3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfonyloxy)phenyl]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)c1cc(OS(=O)(=O)C(F)(F)F)cc(-c2ccc(CI)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H21F6IO5S/c1-12(2)6-18(20(30)33-3)16-7-15(8-17(9-16)34-35(31,32)22(26,27)28)13-4-5-14(11-29)19(10-13)21(23,24)25/h4-5,7-10,12,18H,6,11H2,1-3H3 |
| InChIKey | IOKYTFJGZFWNJY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.36 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|