C21H16F3IO4 — CID 89323164
ethyl (1R,6aR)-4-[2-(iodomethyl)-4-(trifluoromethyl)phenoxy]-6-oxo-1a,6a-dihydro-1H-cyclopropa[a]indene-1-carboxylate (PubChem CID 89323164) has the molecular formula C21H16F3IO4 and a molecular weight of 516.25 g/mol. Its IUPAC name is ethyl (1R,6aR)-4-[2-(iodomethyl)-4-(trifluoromethyl)phenoxy]-6-oxo-1a,6a-dihydro-1H-cyclopropa[a]indene-1-carboxylate.
| Compound Name | ethyl (1R,6aR)-4-[2-(iodomethyl)-4-(trifluoromethyl)phenoxy]-6-oxo-1a,6a-dihydro-1H-cyclopropa[a]indene-1-carboxylate |
|---|---|
| PubChem CID | 89323164 |
| Molecular Formula | C21H16F3IO4 |
| Molecular Weight | 516.25 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | ethyl (1R,6aR)-4-[2-(iodomethyl)-4-(trifluoromethyl)phenoxy]-6-oxo-1a,6a-dihydro-1H-cyclopropa[a]indene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C2c3ccc(Oc4ccc(C(F)(F)F)cc4CI)cc3C(=O)[C@H]21 |
| InChI | InChI=1S/C21H16F3IO4/c1-2-28-20(27)18-16-13-5-4-12(8-14(13)19(26)17(16)18)29-15-6-3-11(21(22,23)24)7-10(15)9-25/h3-8,16-18H,2,9H2,1H3/t16?,17-,18-/m1/s1 |
| InChIKey | YJXZVTWNAHDXGT-UKKPGEIXSA-N |
| XLogP | 5.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|