C21H18F3IN4O3S — CID 89324263
7-(iodomethyl)-6-pyridin-3-yl-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide (PubChem CID 89324263) has the molecular formula C21H18F3IN4O3S and a molecular weight of 590.37 g/mol. Its IUPAC name is 7-(iodomethyl)-6-pyridin-3-yl-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide.
| Compound Name | 7-(iodomethyl)-6-pyridin-3-yl-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 89324263 |
| Molecular Formula | C21H18F3IN4O3S |
| Molecular Weight | 590.37 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 7-(iodomethyl)-6-pyridin-3-yl-2-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide |
| SMILES | NC(=O)c1c(CI)c(-c2cccnc2)n2c1CN(S(=O)(=O)c1ccc(C(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C21H18F3IN4O3S/c22-21(23,24)14-3-5-15(6-4-14)33(31,32)28-8-9-29-17(12-28)18(20(26)30)16(10-25)19(29)13-2-1-7-27-11-13/h1-7,11H,8-10,12H2,(H2,26,30) |
| InChIKey | FWINPXIHEKDBPK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|