C11H19N3O — CID 89324930
5-[2-(dimethylamino)ethoxy]-2-methylbenzene-1,3-diamine (PubChem CID 89324930) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethoxy]-2-methylbenzene-1,3-diamine.
| Compound Name | 5-[2-(dimethylamino)ethoxy]-2-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 89324930 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-[2-(dimethylamino)ethoxy]-2-methylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cc(OCCN(C)C)cc1N |
| InChI | InChI=1S/C11H19N3O/c1-8-10(12)6-9(7-11(8)13)15-5-4-14(2)3/h6-7H,4-5,12-13H2,1-3H3 |
| InChIKey | MFRPTTOSIIFATD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|