C16H21N3OS — CID 21451762
4-[3-[2-(dimethylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 21451762) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-[3-[2-(dimethylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine.
| Compound Name | 4-[3-[2-(dimethylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 21451762 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[3-[2-(dimethylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | CN(C)CCOc1cccc(Sc2ccc(N)c(N)c2)c1 |
| InChI | InChI=1S/C16H21N3OS/c1-19(2)8-9-20-12-4-3-5-13(10-12)21-14-6-7-15(17)16(18)11-14/h3-7,10-11H,8-9,17-18H2,1-2H3 |
| InChIKey | HBPIOQLRNCJDBC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|