C21H31N3OS — CID 21451641
4-[4-[3-(dipropylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 21451641) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 4-[4-[3-(dipropylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine.
| Compound Name | 4-[4-[3-(dipropylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 21451641 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 4-[4-[3-(dipropylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | CCCN(CCC)CCCOc1ccc(Sc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C21H31N3OS/c1-3-12-24(13-4-2)14-5-15-25-17-6-8-18(9-7-17)26-19-10-11-20(22)21(23)16-19/h6-11,16H,3-5,12-15,22-23H2,1-2H3 |
| InChIKey | WDEGMLMRYVZVGX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|