C19H27N3OS — CID 21451705
4-[2-[3-(diethylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 21451705) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 4-[2-[3-(diethylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine.
| Compound Name | 4-[2-[3-(diethylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 21451705 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-[2-[3-(diethylamino)propoxy]phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | CCN(CC)CCCOc1ccccc1Sc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C19H27N3OS/c1-3-22(4-2)12-7-13-23-18-8-5-6-9-19(18)24-15-10-11-16(20)17(21)14-15/h5-6,8-11,14H,3-4,7,12-13,20-21H2,1-2H3 |
| InChIKey | UJRNFTOPAGGMJW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|