C22H33N3OS — CID 21451782
4-[3-[2-(dibutylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine (PubChem CID 21451782) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-[3-[2-(dibutylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine.
| Compound Name | 4-[3-[2-(dibutylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 21451782 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 4-[3-[2-(dibutylamino)ethoxy]phenyl]sulfanylbenzene-1,2-diamine |
| SMILES | CCCCN(CCCC)CCOc1cccc(Sc2ccc(N)c(N)c2)c1 |
| InChI | InChI=1S/C22H33N3OS/c1-3-5-12-25(13-6-4-2)14-15-26-18-8-7-9-19(16-18)27-20-10-11-21(23)22(24)17-20/h7-11,16-17H,3-6,12-15,23-24H2,1-2H3 |
| InChIKey | PLCQZXBWKBZNBA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|