C20H30F6O — CID 89326311
4-cyclohexyl-1-[difluoro-[4-(trifluoromethyl)cyclohexyl]oxymethyl]-2-fluorocyclohexane (PubChem CID 89326311) has the molecular formula C20H30F6O and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-cyclohexyl-1-[difluoro-[4-(trifluoromethyl)cyclohexyl]oxymethyl]-2-fluorocyclohexane.
| Compound Name | 4-cyclohexyl-1-[difluoro-[4-(trifluoromethyl)cyclohexyl]oxymethyl]-2-fluorocyclohexane |
|---|---|
| PubChem CID | 89326311 |
| Molecular Formula | C20H30F6O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-cyclohexyl-1-[difluoro-[4-(trifluoromethyl)cyclohexyl]oxymethyl]-2-fluorocyclohexane |
| SMILES | FC1CC(C2CCCCC2)CCC1C(F)(F)OC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H30F6O/c21-18-12-14(13-4-2-1-3-5-13)6-11-17(18)20(25,26)27-16-9-7-15(8-10-16)19(22,23)24/h13-18H,1-12H2 |
| InChIKey | AJNCKFWLYRSESC-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |