C29H23NO6 — CID 89329547
[4-(4-hydroxyphenyl)phenyl] 4-[[4-(2-methoxy-2-oxoethyl)benzoyl]amino]benzoate (PubChem CID 89329547) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is [4-(4-hydroxyphenyl)phenyl] 4-[[4-(2-methoxy-2-oxoethyl)benzoyl]amino]benzoate.
| Compound Name | [4-(4-hydroxyphenyl)phenyl] 4-[[4-(2-methoxy-2-oxoethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 89329547 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [4-(4-hydroxyphenyl)phenyl] 4-[[4-(2-methoxy-2-oxoethyl)benzoyl]amino]benzoate |
| SMILES | COC(=O)Cc1ccc(C(=O)Nc2ccc(C(=O)Oc3ccc(-c4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H23NO6/c1-35-27(32)18-19-2-4-22(5-3-19)28(33)30-24-12-6-23(7-13-24)29(34)36-26-16-10-21(11-17-26)20-8-14-25(31)15-9-20/h2-17,31H,18H2,1H3,(H,30,33) |
| InChIKey | WBAQSHRBHJXXHY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|