C24H28N2O3 — CID 89330262
(E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-phenylpropyl(propyl)amino]prop-1-enyl]phenyl]prop-2-enamide (PubChem CID 89330262) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-phenylpropyl(propyl)amino]prop-1-enyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-phenylpropyl(propyl)amino]prop-1-enyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 89330262 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (E)-N-hydroxy-3-[3-[(E)-3-oxo-3-[2-phenylpropyl(propyl)amino]prop-1-enyl]phenyl]prop-2-enamide |
| SMILES | CCCN(CC(C)c1ccccc1)C(=O)/C=C/c1cccc(/C=C/C(=O)NO)c1 |
| InChI | InChI=1S/C24H28N2O3/c1-3-16-26(18-19(2)22-10-5-4-6-11-22)24(28)15-13-21-9-7-8-20(17-21)12-14-23(27)25-29/h4-15,17,19,29H,3,16,18H2,1-2H3,(H,25,27)/b14-12+,15-13+ |
| InChIKey | JANYYYWEJPXEGB-QUMQEAAQSA-N |
| XLogP | 4.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|