C12H21NO3 — CID 89330997
butyl N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]carbamate (PubChem CID 89330997) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is butyl N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]carbamate.
| Compound Name | butyl N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]carbamate |
|---|---|
| PubChem CID | 89330997 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | butyl N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]carbamate |
| SMILES | C=C(C)C(=C)OCCNC(=O)OCCCC |
| InChI | InChI=1S/C12H21NO3/c1-5-6-8-16-12(14)13-7-9-15-11(4)10(2)3/h2,4-9H2,1,3H3,(H,13,14) |
| InChIKey | PLCRGOYPNIGXKS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|