C27H33N9O6 — CID 89334565
(2S,3S)-2-amino-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanal (PubChem CID 89334565) has the molecular formula C27H33N9O6 and a molecular weight of 579.62 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanal.
| Compound Name | (2S,3S)-2-amino-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanal |
|---|---|
| PubChem CID | 89334565 |
| Molecular Formula | C27H33N9O6 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | (2S,3S)-2-amino-3-[2-[[4,7-bis[(4-nitro-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-pyridinyl]-3-hydroxypropanal |
| SMILES | N[C@H](C=O)[C@@H](O)c1ccnc(CN2CCN(Cc3cc([N+](=O)[O-])ccn3)CCN(Cc3cc([N+](=O)[O-])ccn3)CC2)c1 |
| InChI | InChI=1S/C27H33N9O6/c28-26(19-37)27(38)20-1-4-29-21(13-20)16-32-7-9-33(17-22-14-24(35(39)40)2-5-30-22)11-12-34(10-8-32)18-23-15-25(36(41)42)3-6-31-23/h1-6,13-15,19,26-27,38H,7-12,16-18,28H2/t26-,27+/m1/s1 |
| InChIKey | DAXMCZIGPWBGHZ-SXOMAYOGSA-N |
| XLogP | 1.07 |
| TPSA | 197.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|