C25H24F2N4O — CID 89336572
1-(2,6-difluorophenyl)-2-[[4-(2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 89336572) has the molecular formula C25H24F2N4O and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[[4-(2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,6-difluorophenyl)-2-[[4-(2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 89336572 |
| Molecular Formula | C25H24F2N4O |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[[4-(2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(C(=O)N2CCCCc3ccccc32)cc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C25H24F2N4O/c26-20-8-5-9-21(27)23(20)30-25(28)29-16-17-11-13-19(14-12-17)24(32)31-15-4-3-7-18-6-1-2-10-22(18)31/h1-2,5-6,8-14H,3-4,7,15-16H2,(H3,28,29,30) |
| InChIKey | AQQZAKPRYYKTKZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|