C28H34N4O3 — CID 89337368
(10R,15S)-10-cyclohexa-2,4-dien-1-yl-4-ethoxy-15-methyl-13-[2-[methyl(prop-2-enyl)amino]ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 89337368) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is (10R,15S)-10-cyclohexa-2,4-dien-1-yl-4-ethoxy-15-methyl-13-[2-[methyl(prop-2-enyl)amino]ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (10R,15S)-10-cyclohexa-2,4-dien-1-yl-4-ethoxy-15-methyl-13-[2-[methyl(prop-2-enyl)amino]ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 89337368 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (10R,15S)-10-cyclohexa-2,4-dien-1-yl-4-ethoxy-15-methyl-13-[2-[methyl(prop-2-enyl)amino]ethyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | C=CCN(C)CCN1C(=O)N2[C@H](C3C=CC=CC3)c3[nH]c4ccc(OCC)cc4c3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C28H34N4O3/c1-5-14-30(4)15-16-31-26(33)28(3)18-22-21-17-20(35-6-2)12-13-23(21)29-24(22)25(32(28)27(31)34)19-10-8-7-9-11-19/h5,7-10,12-13,17,19,25,29H,1,6,11,14-16,18H2,2-4H3/t19?,25-,28+/m1/s1 |
| InChIKey | SRZBNGNEVBCCSR-NXJMBUBCSA-N |
| XLogP | 4.44 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|