C10H8INO3 — CID 89337937
methyl 4-(iodomethyl)furo[2,3-b]pyridine-2-carboxylate (PubChem CID 89337937) has the molecular formula C10H8INO3 and a molecular weight of 317.08 g/mol. Its IUPAC name is methyl 4-(iodomethyl)furo[2,3-b]pyridine-2-carboxylate.
| Compound Name | methyl 4-(iodomethyl)furo[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 89337937 |
| Molecular Formula | C10H8INO3 |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | methyl 4-(iodomethyl)furo[2,3-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2c(CI)ccnc2o1 |
| InChI | InChI=1S/C10H8INO3/c1-14-10(13)8-4-7-6(5-11)2-3-12-9(7)15-8/h2-4H,5H2,1H3 |
| InChIKey | UQOSCOLUCAELOD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|