C39H72N10O6S — CID 89339608
4-[[(4R)-4-[(1R,2R,4S,5S,9S,11R,13R,15R)-4,11,15-tris(3-azidopropoxy)-1,2,5-trimethyl-6-tricyclo[11.4.0.05,9]heptadecanyl]pentyl]amino]butyl methanesulfonate (PubChem CID 89339608) has the molecular formula C39H72N10O6S and a molecular weight of 809.14 g/mol. Its IUPAC name is 4-[[(4R)-4-[(1R,2R,4S,5S,9S,11R,13R,15R)-4,11,15-tris(3-azidopropoxy)-1,2,5-trimethyl-6-tricyclo[11.4.0.05,9]heptadecanyl]pentyl]amino]butyl methanesulfonate.
| Compound Name | 4-[[(4R)-4-[(1R,2R,4S,5S,9S,11R,13R,15R)-4,11,15-tris(3-azidopropoxy)-1,2,5-trimethyl-6-tricyclo[11.4.0.05,9]heptadecanyl]pentyl]amino]butyl methanesulfonate |
|---|---|
| PubChem CID | 89339608 |
| Molecular Formula | C39H72N10O6S |
| Molecular Weight | 809.14 g/mol |
| Exact Mass | 808.54 |
| IUPAC Name | 4-[[(4R)-4-[(1R,2R,4S,5S,9S,11R,13R,15R)-4,11,15-tris(3-azidopropoxy)-1,2,5-trimethyl-6-tricyclo[11.4.0.05,9]heptadecanyl]pentyl]amino]butyl methanesulfonate |
| SMILES | C[C@H](CCCNCCCCOS(C)(=O)=O)C1CC[C@H]2C[C@H](OCCCN=[N+]=[N-])C[C@H]3C[C@H](OCCCN=[N+]=[N-])CC[C@]3(C)[C@H](C)C[C@H](OCCCN=[N+]=[N-])[C@]12C |
| InChI | InChI=1S/C39H72N10O6S/c1-30(12-8-18-43-17-6-7-25-55-56(5,50)51)36-14-13-32-27-35(53-23-10-20-45-48-41)29-33-28-34(52-22-9-19-44-47-40)15-16-38(33,3)31(2)26-37(39(32,36)4)54-24-11-21-46-49-42/h30-37,43H,6-29H2,1-5H3/t30-,31-,32+,33-,34-,35+,36?,37+,38-,39+/m1/s1 |
| InChIKey | VRQSCMGNSIQWEM-CMKLJGPDSA-N |
| XLogP | 9.66 |
| TPSA | 229.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.14 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|