C31H53N9O6S — CID 76723539
4-[3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl methanesulfonate (PubChem CID 76723539) has the molecular formula C31H53N9O6S and a molecular weight of 679.89 g/mol. Its IUPAC name is 4-[3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl methanesulfonate.
| Compound Name | 4-[3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl methanesulfonate |
|---|---|
| PubChem CID | 76723539 |
| Molecular Formula | C31H53N9O6S |
| Molecular Weight | 679.89 g/mol |
| Exact Mass | 679.38 |
| IUPAC Name | 4-[3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl methanesulfonate |
| SMILES | CC(CCCOS(C)(=O)=O)C1CCC2C3C(OCCN=[N+]=[N-])CC4CC(OCCN=[N+]=[N-])CCC4(C)C3CC(OCCN=[N+]=[N-])C12C |
| InChI | InChI=1S/C31H53N9O6S/c1-21(6-5-14-46-47(4,41)42)24-7-8-25-29-26(20-28(31(24,25)3)45-17-13-37-40-34)30(2)10-9-23(43-15-11-35-38-32)18-22(30)19-27(29)44-16-12-36-39-33/h21-29H,5-20H2,1-4H3 |
| InChIKey | QAYVMUOUOPCBIS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 217.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.89 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|