C28H47N9O3 — CID 71173730
(7R,9S,10S,13R,14S,17R)-3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 71173730) has the molecular formula C28H47N9O3 and a molecular weight of 557.74 g/mol. Its IUPAC name is (7R,9S,10S,13R,14S,17R)-3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (7R,9S,10S,13R,14S,17R)-3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 71173730 |
| Molecular Formula | C28H47N9O3 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.38 |
| IUPAC Name | (7R,9S,10S,13R,14S,17R)-3,7,12-tris(2-azidoethoxy)-10,13-dimethyl-17-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)[C@H]1CC[C@H]2C3C(OCCN=[N+]=[N-])CC4CC(OCCN=[N+]=[N-])CC[C@]4(C)[C@H]3CC(OCCN=[N+]=[N-])[C@]12C |
| InChI | InChI=1S/C28H47N9O3/c1-18(2)21-5-6-22-26-23(17-25(28(21,22)4)40-14-11-34-37-31)27(3)8-7-20(38-12-9-32-35-29)15-19(27)16-24(26)39-13-10-33-36-30/h18-26H,5-17H2,1-4H3/t19?,20?,21-,22+,23+,24?,25?,26?,27+,28-/m1/s1 |
| InChIKey | ROWXNNOQYHAGJH-MDBAFRDLSA-N |
| XLogP | 7.61 |
| TPSA | 173.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|