C16H18N2 — CID 89340469
N'-[3-[(E)-2-phenylethenyl]phenyl]ethane-1,2-diamine (PubChem CID 89340469) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N'-[3-[(E)-2-phenylethenyl]phenyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[(E)-2-phenylethenyl]phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 89340469 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N'-[3-[(E)-2-phenylethenyl]phenyl]ethane-1,2-diamine |
| SMILES | NCCNc1cccc(/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C16H18N2/c17-11-12-18-16-8-4-7-15(13-16)10-9-14-5-2-1-3-6-14/h1-10,13,18H,11-12,17H2/b10-9+ |
| InChIKey | HLSRCKUBRHZRDL-MDZDMXLPSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|