C21H20N3O3+ — CID 8934095
(2R)-N-(4-cyanophenyl)-2-(6,7-dimethoxyisoquinolin-2-ium-2-yl)propanamide (PubChem CID 8934095) has the molecular formula C21H20N3O3+ and a molecular weight of 362.41 g/mol. Its IUPAC name is (2R)-N-(4-cyanophenyl)-2-(6,7-dimethoxyisoquinolin-2-ium-2-yl)propanamide.
| Compound Name | (2R)-N-(4-cyanophenyl)-2-(6,7-dimethoxyisoquinolin-2-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 8934095 |
| Molecular Formula | C21H20N3O3+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2R)-N-(4-cyanophenyl)-2-(6,7-dimethoxyisoquinolin-2-ium-2-yl)propanamide |
| SMILES | COc1cc2cc[n+]([C@H](C)C(=O)Nc3ccc(C#N)cc3)cc2cc1OC |
| InChI | InChI=1S/C21H19N3O3/c1-14(21(25)23-18-6-4-15(12-22)5-7-18)24-9-8-16-10-19(26-2)20(27-3)11-17(16)13-24/h4-11,13-14H,1-3H3/p+1/t14-/m1/s1 |
| InChIKey | ZOTCMIUUMJOSDH-CQSZACIVSA-O |
| XLogP | 3.22 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|