C14H12FIN4 — CID 89342227
6-(2-fluorophenyl)-4-(iodomethyl)-1,3-dimethylpyrazolo[3,4-d]pyrimidine (PubChem CID 89342227) has the molecular formula C14H12FIN4 and a molecular weight of 382.18 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-4-(iodomethyl)-1,3-dimethylpyrazolo[3,4-d]pyrimidine.
| Compound Name | 6-(2-fluorophenyl)-4-(iodomethyl)-1,3-dimethylpyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 89342227 |
| Molecular Formula | C14H12FIN4 |
| Molecular Weight | 382.18 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 6-(2-fluorophenyl)-4-(iodomethyl)-1,3-dimethylpyrazolo[3,4-d]pyrimidine |
| SMILES | Cc1nn(C)c2nc(-c3ccccc3F)nc(CI)c12 |
| InChI | InChI=1S/C14H12FIN4/c1-8-12-11(7-16)17-13(18-14(12)20(2)19-8)9-5-3-4-6-10(9)15/h3-6H,7H2,1-2H3 |
| InChIKey | GXTCSWWUJQFOMN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|