C19H25FIN9O3 — CID 89342701
[N'-[[4-[N'-[4-fluoro-3-(iodomethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]urea (PubChem CID 89342701) has the molecular formula C19H25FIN9O3 and a molecular weight of 573.37 g/mol. Its IUPAC name is [N'-[[4-[N'-[4-fluoro-3-(iodomethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]urea.
| Compound Name | [N'-[[4-[N'-[4-fluoro-3-(iodomethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 89342701 |
| Molecular Formula | C19H25FIN9O3 |
| Molecular Weight | 573.37 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | [N'-[[4-[N'-[4-fluoro-3-(iodomethyl)phenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]methyl]-N-(2-morpholin-4-ylethyl)carbamimidoyl]urea |
| SMILES | NC(=O)N/C(=N/Cc1nonc1/C(N)=N/c1ccc(F)c(CI)c1)NCCN1CCOCC1 |
| InChI | InChI=1S/C19H25FIN9O3/c20-14-2-1-13(9-12(14)10-21)26-17(22)16-15(28-33-29-16)11-25-19(27-18(23)31)24-3-4-30-5-7-32-8-6-30/h1-2,9H,3-8,10-11H2,(H2,22,26)(H4,23,24,25,27,31) |
| InChIKey | CNSOUFBKDNCLCE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|