C43H43N — CID 89342945
9-[4-[7-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl]cyclohexa-1,3-dien-1-yl]carbazole (PubChem CID 89342945) has the molecular formula C43H43N and a molecular weight of 573.82 g/mol. Its IUPAC name is 9-[4-[7-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl]cyclohexa-1,3-dien-1-yl]carbazole.
| Compound Name | 9-[4-[7-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl]cyclohexa-1,3-dien-1-yl]carbazole |
|---|---|
| PubChem CID | 89342945 |
| Molecular Formula | C43H43N |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | 9-[4-[7-(3,4,5,6,7,8-hexahydronaphthalen-2-yl)-9,9-dimethyl-3,4,8,8a-tetrahydrofluoren-2-yl]cyclohexa-1,3-dien-1-yl]carbazole |
| SMILES | CC1(C)C2=C(CCC(C3=CC=C(n4c5ccccc5c5ccccc54)CC3)=C2)C2=CC=C(C3=CC4=C(CCCC4)CC3)CC21 |
| InChI | InChI=1S/C43H43N/c1-43(2)39-26-32(29-17-21-34(22-18-29)44-41-13-7-5-11-37(41)38-12-6-8-14-42(38)44)19-23-35(39)36-24-20-33(27-40(36)43)31-16-15-28-9-3-4-10-30(28)25-31/h5-8,11-14,17,20-21,24-26,40H,3-4,9-10,15-16,18-19,22-23,27H2,1-2H3 |
| InChIKey | AFMHESHQJVNKHR-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |