C20H17FN4O5 — CID 89344425
N-[4-[4-[[6-(fluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]formamide (PubChem CID 89344425) has the molecular formula C20H17FN4O5 and a molecular weight of 412.38 g/mol. Its IUPAC name is N-[4-[4-[[6-(fluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]formamide.
| Compound Name | N-[4-[4-[[6-(fluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]formamide |
|---|---|
| PubChem CID | 89344425 |
| Molecular Formula | C20H17FN4O5 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[4-[4-[[6-(fluoromethoxy)-3-oxo-1H-isoindol-2-yl]methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]formamide |
| SMILES | O=CNc1ccc(C2(CN3Cc4cc(OCF)ccc4C3=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C20H17FN4O5/c21-10-30-15-5-6-16-12(7-15)8-25(17(16)27)9-20(18(28)23-19(29)24-20)13-1-3-14(4-2-13)22-11-26/h1-7,11H,8-10H2,(H,22,26)(H2,23,24,28,29) |
| InChIKey | NWPVBCLBYLPTSL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|