C18H20IN3O2 — CID 89346451
3-[2,4-diethyl-5-[(E)-2-methoxyethenyl]pyrazol-3-yl]oxy-5-(iodomethyl)benzonitrile (PubChem CID 89346451) has the molecular formula C18H20IN3O2 and a molecular weight of 437.28 g/mol. Its IUPAC name is 3-[2,4-diethyl-5-[(E)-2-methoxyethenyl]pyrazol-3-yl]oxy-5-(iodomethyl)benzonitrile.
| Compound Name | 3-[2,4-diethyl-5-[(E)-2-methoxyethenyl]pyrazol-3-yl]oxy-5-(iodomethyl)benzonitrile |
|---|---|
| PubChem CID | 89346451 |
| Molecular Formula | C18H20IN3O2 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 3-[2,4-diethyl-5-[(E)-2-methoxyethenyl]pyrazol-3-yl]oxy-5-(iodomethyl)benzonitrile |
| SMILES | CCc1c(/C=C/OC)nn(CC)c1Oc1cc(C#N)cc(CI)c1 |
| InChI | InChI=1S/C18H20IN3O2/c1-4-16-17(6-7-23-3)21-22(5-2)18(16)24-15-9-13(11-19)8-14(10-15)12-20/h6-10H,4-5,11H2,1-3H3/b7-6+ |
| InChIKey | OENOLWWHDGHVLO-VOTSOKGWSA-N |
| XLogP | 4.68 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|