C20H25NO6 — CID 89348931
(2R,4S,5S)-2-[benzyl(phenylmethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89348931) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2R,4S,5S)-2-[benzyl(phenylmethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,4S,5S)-2-[benzyl(phenylmethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89348931 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2R,4S,5S)-2-[benzyl(phenylmethoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](N(Cc2ccccc2)OCc2ccccc2)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25NO6/c22-12-16-17(23)18(24)19(25)20(27-16)21(11-14-7-3-1-4-8-14)26-13-15-9-5-2-6-10-15/h1-10,16-20,22-25H,11-13H2/t16?,17-,18+,19?,20-/m1/s1 |
| InChIKey | DZJMQDNQYSARSP-QMANHMLOSA-N |
| XLogP | 0.42 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|