C14H21NO6 — CID 53308497
(2R,3R,4S,5S,6R)-2-[benzyl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53308497) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[benzyl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[benzyl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53308497 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[benzyl(methoxy)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CON(Cc1ccccc1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H21NO6/c1-20-15(7-9-5-3-2-4-6-9)14-13(19)12(18)11(17)10(8-16)21-14/h2-6,10-14,16-19H,7-8H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | PROXLJCCGIPILW-RKQHYHRCSA-N |
| XLogP | -1.15 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|