C12H16F6NO4S2- — CID 89348985
3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfinate (PubChem CID 89348985) has the molecular formula C12H16F6NO4S2- and a molecular weight of 416.39 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfinate.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfinate |
|---|---|
| PubChem CID | 89348985 |
| Molecular Formula | C12H16F6NO4S2- |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylsulfonyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C12H17F6NO4S2/c13-10(14,11(15,16)24(20)21)12(17,18)25(22,23)19-6-5-8-3-1-2-4-9(8)7-19/h8-9H,1-7H2,(H,20,21)/p-1 |
| InChIKey | RTHMSPGVOWHQTN-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|