C10H16F2NO5S2- — CID 58961835
1-[difluoro(oxidoperoxysulfanyl)methyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 58961835) has the molecular formula C10H16F2NO5S2- and a molecular weight of 332.37 g/mol. Its IUPAC name is 1-[difluoro(oxidoperoxysulfanyl)methyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-[difluoro(oxidoperoxysulfanyl)methyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 58961835 |
| Molecular Formula | C10H16F2NO5S2- |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 1-[difluoro(oxidoperoxysulfanyl)methyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | O=S(=O)(N1CCCC2CCCCC21)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C10H17F2NO5S2/c11-10(12,19-18-17-14)20(15,16)13-7-3-5-8-4-1-2-6-9(8)13/h8-9,14H,1-7H2/p-1 |
| InChIKey | MWCVEVTXFMNRMG-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|