C45H56N2 — CID 89352868
2-N-cyclohexa-2,4-dien-1-yl-1-N-methyl-2-N-[6-[10-(2-methylhept-1-en-4-yl)-1,2,3,5,6,9a-hexahydroanthracen-9-yl]-1,7,8,8a-tetrahydronaphthalen-2-yl]cyclohexa-1,3-diene-1,2-diamine (PubChem CID 89352868) has the molecular formula C45H56N2 and a molecular weight of 624.96 g/mol. Its IUPAC name is 2-N-cyclohexa-2,4-dien-1-yl-1-N-methyl-2-N-[6-[10-(2-methylhept-1-en-4-yl)-1,2,3,5,6,9a-hexahydroanthracen-9-yl]-1,7,8,8a-tetrahydronaphthalen-2-yl]cyclohexa-1,3-diene-1,2-diamine.
| Compound Name | 2-N-cyclohexa-2,4-dien-1-yl-1-N-methyl-2-N-[6-[10-(2-methylhept-1-en-4-yl)-1,2,3,5,6,9a-hexahydroanthracen-9-yl]-1,7,8,8a-tetrahydronaphthalen-2-yl]cyclohexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 89352868 |
| Molecular Formula | C45H56N2 |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 624.44 |
| IUPAC Name | 2-N-cyclohexa-2,4-dien-1-yl-1-N-methyl-2-N-[6-[10-(2-methylhept-1-en-4-yl)-1,2,3,5,6,9a-hexahydroanthracen-9-yl]-1,7,8,8a-tetrahydronaphthalen-2-yl]cyclohexa-1,3-diene-1,2-diamine |
| SMILES | C=C(C)CC(CCC)C1=C2CCC=CC2=C(C2=CC3=CC=C(N(C4=C(NC)CCC=C4)C4C=CC=CC4)CC3CC2)C2CCCC=C12 |
| InChI | InChI=1S/C45H56N2/c1-5-15-34(28-31(2)3)44-38-18-9-11-20-40(38)45(41-21-12-10-19-39(41)44)35-25-24-33-30-37(27-26-32(33)29-35)47(36-16-7-6-8-17-36)43-23-14-13-22-42(43)46-4/h6-8,11,14,16,19-20,23,26-27,29,33-34,36,41,46H,2,5,9-10,12-13,15,17-18,21-22,24-25,28,30H2,1,3-4H3 |
| InChIKey | SIYHMXVYWALUHQ-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|