C31H39O7PS2 — CID 89353294
(3S,5R)-2-diethoxyphosphinothioylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 89353294) has the molecular formula C31H39O7PS2 and a molecular weight of 618.75 g/mol. Its IUPAC name is (3S,5R)-2-diethoxyphosphinothioylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (3S,5R)-2-diethoxyphosphinothioylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 89353294 |
| Molecular Formula | C31H39O7PS2 |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | (3S,5R)-2-diethoxyphosphinothioylsulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CCOP(=S)(OCC)SC1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C31H39O7PS2/c1-3-36-39(40,37-4-2)41-31-28(32)30(35-22-26-18-12-7-13-19-26)29(34-21-25-16-10-6-11-17-25)27(38-31)23-33-20-24-14-8-5-9-15-24/h5-19,27-32H,3-4,20-23H2,1-2H3/t27?,28-,29+,30?,31?/m0/s1 |
| InChIKey | WKUDJSMAEGEEIM-ZXNBJGMGSA-N |
| XLogP | 6.49 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|