C22H23F3N4O — CID 89354162
4-methoxy-N-[1-[4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]butan-1-amine (PubChem CID 89354162) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 4-methoxy-N-[1-[4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]butan-1-amine.
| Compound Name | 4-methoxy-N-[1-[4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]butan-1-amine |
|---|---|
| PubChem CID | 89354162 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-methoxy-N-[1-[4-[3-pyridin-3-yl-5-(trifluoromethyl)pyrazol-1-yl]phenyl]ethenyl]butan-1-amine |
| SMILES | C=C(NCCCCOC)c1ccc(-n2nc(-c3cccnc3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H23F3N4O/c1-16(27-12-3-4-13-30-2)17-7-9-19(10-8-17)29-21(22(23,24)25)14-20(28-29)18-6-5-11-26-15-18/h5-11,14-15,27H,1,3-4,12-13H2,2H3 |
| InChIKey | HQPKQSMOEDPVMB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|