C12H16N2O4 — CID 89355065
2-[(2,4-dimethoxyphenyl)diazenyl]propyl formate (PubChem CID 89355065) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)diazenyl]propyl formate.
| Compound Name | 2-[(2,4-dimethoxyphenyl)diazenyl]propyl formate |
|---|---|
| PubChem CID | 89355065 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)diazenyl]propyl formate |
| SMILES | COc1ccc(/N=N/C(C)COC=O)c(OC)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-9(7-18-8-15)13-14-11-5-4-10(16-2)6-12(11)17-3/h4-6,8-9H,7H2,1-3H3/b14-13+ |
| InChIKey | CKYRRDDJADLGRS-BUHFOSPRSA-N |
| XLogP | 2.35 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|