C30H38O10 — CID 89355659
[(1S,4R,6R,8S,9S,11R,14S)-4-acetyloxy-1,8,11-trihydroxy-9,13,16,16-tetramethyl-10-oxo-5-oxatetracyclo[10.3.1.03,9.04,6]hexadec-12-en-14-yl] (2R)-2-hydroxy-3-phenylpropanoate (PubChem CID 89355659) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is [(1S,4R,6R,8S,9S,11R,14S)-4-acetyloxy-1,8,11-trihydroxy-9,13,16,16-tetramethyl-10-oxo-5-oxatetracyclo[10.3.1.03,9.04,6]hexadec-12-en-14-yl] (2R)-2-hydroxy-3-phenylpropanoate.
| Compound Name | [(1S,4R,6R,8S,9S,11R,14S)-4-acetyloxy-1,8,11-trihydroxy-9,13,16,16-tetramethyl-10-oxo-5-oxatetracyclo[10.3.1.03,9.04,6]hexadec-12-en-14-yl] (2R)-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 89355659 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [(1S,4R,6R,8S,9S,11R,14S)-4-acetyloxy-1,8,11-trihydroxy-9,13,16,16-tetramethyl-10-oxo-5-oxatetracyclo[10.3.1.03,9.04,6]hexadec-12-en-14-yl] (2R)-2-hydroxy-3-phenylpropanoate |
| SMILES | CC(=O)O[C@@]12O[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)Cc4ccccc4)C[C@@](O)(CC21)C3(C)C |
| InChI | InChI=1S/C30H38O10/c1-15-19(38-26(36)18(32)11-17-9-7-6-8-10-17)13-29(37)14-20-28(5,25(35)24(34)23(15)27(29,3)4)21(33)12-22-30(20,40-22)39-16(2)31/h6-10,18-22,24,32-34,37H,11-14H2,1-5H3/t18-,19+,20?,21+,22-,24-,28+,29-,30+/m1/s1 |
| InChIKey | WMIXVJMGWPGKKC-DGYXWNTISA-N |
| XLogP | 1.36 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|