C30H40N3O12P — CID 89356541
2-[[2-[bis(carboxymethyl)amino]-3-[1,3-diphenylpropan-2-yloxy(hydroxy)phosphoryl]oxypropyl]-[2-[bis(2-oxoethyl)amino]ethyl]amino]acetic acid (PubChem CID 89356541) has the molecular formula C30H40N3O12P and a molecular weight of 665.63 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-3-[1,3-diphenylpropan-2-yloxy(hydroxy)phosphoryl]oxypropyl]-[2-[bis(2-oxoethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-3-[1,3-diphenylpropan-2-yloxy(hydroxy)phosphoryl]oxypropyl]-[2-[bis(2-oxoethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 89356541 |
| Molecular Formula | C30H40N3O12P |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 665.23 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-3-[1,3-diphenylpropan-2-yloxy(hydroxy)phosphoryl]oxypropyl]-[2-[bis(2-oxoethyl)amino]ethyl]amino]acetic acid |
| SMILES | O=CCN(CC=O)CCN(CC(=O)O)CC(COP(=O)(O)OC(Cc1ccccc1)Cc1ccccc1)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C30H40N3O12P/c34-15-13-31(14-16-35)11-12-32(20-28(36)37)19-26(33(21-29(38)39)22-30(40)41)23-44-46(42,43)45-27(17-24-7-3-1-4-8-24)18-25-9-5-2-6-10-25/h1-10,15-16,26-27H,11-14,17-23H2,(H,36,37)(H,38,39)(H,40,41)(H,42,43) |
| InChIKey | NXWMSMHKTNBLRQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 211.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|