C29H32F4N2O2 — CID 89360201
N-cyclopentyl-N'-[1-(3,4-dimethoxyphenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]methanediamine (PubChem CID 89360201) has the molecular formula C29H32F4N2O2 and a molecular weight of 516.58 g/mol. Its IUPAC name is N-cyclopentyl-N'-[1-(3,4-dimethoxyphenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]methanediamine.
| Compound Name | N-cyclopentyl-N'-[1-(3,4-dimethoxyphenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]methanediamine |
|---|---|
| PubChem CID | 89360201 |
| Molecular Formula | C29H32F4N2O2 |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | N-cyclopentyl-N'-[1-(3,4-dimethoxyphenyl)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]methanediamine |
| SMILES | COc1ccc(C(Cc2ccccc2)(NCNC2CCCC2)c2cc(F)cc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C29H32F4N2O2/c1-36-26-13-12-21(17-27(26)37-2)28(18-20-8-4-3-5-9-20,35-19-34-25-10-6-7-11-25)22-14-23(29(31,32)33)16-24(30)15-22/h3-5,8-9,12-17,25,34-35H,6-7,10-11,18-19H2,1-2H3 |
| InChIKey | YGCHUWGRKMWFRG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|