C29H38F6O3 — CID 89364452
(Z,2R,8E)-8-[(7aS)-7a-methyl-1-[1-[(Z)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]-6-ethenyloct-6-ene-2,4-diol (PubChem CID 89364452) has the molecular formula C29H38F6O3 and a molecular weight of 548.61 g/mol. Its IUPAC name is (Z,2R,8E)-8-[(7aS)-7a-methyl-1-[1-[(Z)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]-6-ethenyloct-6-ene-2,4-diol.
| Compound Name | (Z,2R,8E)-8-[(7aS)-7a-methyl-1-[1-[(Z)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]-6-ethenyloct-6-ene-2,4-diol |
|---|---|
| PubChem CID | 89364452 |
| Molecular Formula | C29H38F6O3 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | (Z,2R,8E)-8-[(7aS)-7a-methyl-1-[1-[(Z)-5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pent-2-enyl]cyclopropyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]-6-ethenyloct-6-ene-2,4-diol |
| SMILES | C=C/C(=C\C=C1/CCC[C@]2(C)C(C3(C/C=C\C(O)(C(F)(F)F)C(F)(F)F)CC3)=CCC12)CC(O)C[C@@H](C)O |
| InChI | InChI=1S/C29H38F6O3/c1-4-20(18-22(37)17-19(2)36)8-9-21-7-5-12-25(3)23(21)10-11-24(25)26(15-16-26)13-6-14-27(38,28(30,31)32)29(33,34)35/h4,6,8-9,11,14,19,22-23,36-38H,1,5,7,10,12-13,15-18H2,2-3H3/b14-6-,20-8+,21-9+/t19-,22?,23?,25+/m1/s1 |
| InChIKey | BNJKUXLWFQFRCA-YQJFZHFJSA-N |
| XLogP | 7.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|