C25H43NO8 — CID 89374528
3-[6-carboxy-2-ethyl-2,4,6-trimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]heptanoyl]oxy-N-hydroxybicyclo[2.2.1]heptan-2-amine oxide (PubChem CID 89374528) has the molecular formula C25H43NO8 and a molecular weight of 485.62 g/mol. Its IUPAC name is 3-[6-carboxy-2-ethyl-2,4,6-trimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]heptanoyl]oxy-N-hydroxybicyclo[2.2.1]heptan-2-amine oxide.
| Compound Name | 3-[6-carboxy-2-ethyl-2,4,6-trimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]heptanoyl]oxy-N-hydroxybicyclo[2.2.1]heptan-2-amine oxide |
|---|---|
| PubChem CID | 89374528 |
| Molecular Formula | C25H43NO8 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-[6-carboxy-2-ethyl-2,4,6-trimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]heptanoyl]oxy-N-hydroxybicyclo[2.2.1]heptan-2-amine oxide |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)O)C(=O)OC(C)(C)C)C(=O)OC1C2CCC(C2)C1[NH+]([O-])O |
| InChI | InChI=1S/C25H43NO8/c1-9-24(7,20(29)33-18-16-11-10-15(12-16)17(18)26(31)32)14-25(8,13-23(5,6)19(27)28)21(30)34-22(2,3)4/h15-18,26,31H,9-14H2,1-8H3,(H,27,28) |
| InChIKey | OJHNBVHFYDNDBC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|