About 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide
4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide (PubChem CID 89374588) has the molecular formula C9H19N3O2
and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide |
| PubChem CID | 89374588 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CCC(OCOC)CC1 |
| InChI | InChI=1S/C9H19N3O2/c1-11-9(10)12-5-3-8(4-6-12)14-7-13-2/h8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | UBJGJTNYPSNQRV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide?
The IUPAC name of 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide (CID 89374588) is 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide.
What is the SMILES notation for 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide?
The canonical SMILES for 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide is C/N=C(\N)N1CCC(OCOC)CC1.
What is the InChIKey of 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide?
The InChIKey is UBJGJTNYPSNQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2/c1-11-9(10)12-5-3-8(4-6-12)14-7-13-2/h8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide?
4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide has a molecular weight of 201.27 g/mol, XLogP of 0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethoxy)-N'-methylpiperidine-1-carboximidamide is sourced from PubChem (CID 89374588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).