About N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine
N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine (PubChem CID 89374740) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine.
Analyze N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine?
The IUPAC name of N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine (CID 89374740) is N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine.
What is the SMILES notation for N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine?
The canonical SMILES for N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine is C=C1CCc2ccc(N(C)C)cc21.
What is the InChIKey of N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine?
The InChIKey is LVRJWSWQFDWBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-9-4-5-10-6-7-11(13(2)3)8-12(9)10/h6-8H,1,4-5H2,2-3H3.
What are the key properties of N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine?
N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine has a molecular weight of 173.26 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-methylidene-1,2-dihydroinden-5-amine is sourced from PubChem (CID 89374740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).