C22H20N2O4 — CID 89378013
3-[[(3E)-4-(3,4-dihydroxyphenyl)buta-1,3-dien-2-yl]amino]-3-quinolin-3-ylpropanoic acid (PubChem CID 89378013) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-[[(3E)-4-(3,4-dihydroxyphenyl)buta-1,3-dien-2-yl]amino]-3-quinolin-3-ylpropanoic acid.
| Compound Name | 3-[[(3E)-4-(3,4-dihydroxyphenyl)buta-1,3-dien-2-yl]amino]-3-quinolin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 89378013 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-[[(3E)-4-(3,4-dihydroxyphenyl)buta-1,3-dien-2-yl]amino]-3-quinolin-3-ylpropanoic acid |
| SMILES | C=C(/C=C/c1ccc(O)c(O)c1)NC(CC(=O)O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C22H20N2O4/c1-14(6-7-15-8-9-20(25)21(26)10-15)24-19(12-22(27)28)17-11-16-4-2-3-5-18(16)23-13-17/h2-11,13,19,24-26H,1,12H2,(H,27,28)/b7-6+ |
| InChIKey | LOWSPNLFFXSDDL-VOTSOKGWSA-N |
| XLogP | 3.98 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|