C8H6ClN3O3 — CID 89378308
6-amino-7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid (PubChem CID 89378308) has the molecular formula C8H6ClN3O3 and a molecular weight of 227.61 g/mol. Its IUPAC name is 6-amino-7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid.
| Compound Name | 6-amino-7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 89378308 |
| Molecular Formula | C8H6ClN3O3 |
| Molecular Weight | 227.61 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 6-amino-7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid |
| SMILES | Nc1c(C(=O)O)cc2[nH]c(=O)[nH]c2c1Cl |
| InChI | InChI=1S/C8H6ClN3O3/c9-4-5(10)2(7(13)14)1-3-6(4)12-8(15)11-3/h1H,10H2,(H,13,14)(H2,11,12,15) |
| InChIKey | SYYNOBYVNIZBCE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.61 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|