C8H8ClN3O — CID 67903569
4-amino-6-(chloromethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 67903569) has the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. Its IUPAC name is 4-amino-6-(chloromethyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 4-amino-6-(chloromethyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 67903569 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 4-amino-6-(chloromethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | Nc1cc(CCl)cc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C8H8ClN3O/c9-3-4-1-5(10)7-6(2-4)11-8(13)12-7/h1-2H,3,10H2,(H2,11,12,13) |
| InChIKey | RMJQOWDMHOMWOK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|