C22H24N3O2S+ — CID 8938021
dimethyl-[(2S)-2-phenyl-2-[[3-(thiophene-2-carbonylamino)benzoyl]amino]ethyl]azanium (PubChem CID 8938021) has the molecular formula C22H24N3O2S+ and a molecular weight of 394.52 g/mol. Its IUPAC name is dimethyl-[(2S)-2-phenyl-2-[[3-(thiophene-2-carbonylamino)benzoyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[(2S)-2-phenyl-2-[[3-(thiophene-2-carbonylamino)benzoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8938021 |
| Molecular Formula | C22H24N3O2S+ |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | dimethyl-[(2S)-2-phenyl-2-[[3-(thiophene-2-carbonylamino)benzoyl]amino]ethyl]azanium |
| SMILES | C[NH+](C)C[C@@H](NC(=O)c1cccc(NC(=O)c2cccs2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-25(2)15-19(16-8-4-3-5-9-16)24-21(26)17-10-6-11-18(14-17)23-22(27)20-12-7-13-28-20/h3-14,19H,15H2,1-2H3,(H,23,27)(H,24,26)/p+1/t19-/m1/s1 |
| InChIKey | ZFLIHDLLAUXSSJ-LJQANCHMSA-O |
| XLogP | 2.62 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |